About dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol)
dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) (PubChem CID 20870809) has the molecular formula C32H34Cl2N2O2Zr
and a molecular weight of 640.77 g/mol. Its IUPAC name is dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol).
Molecular Properties
| Compound Name | dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) |
| PubChem CID | 20870809 |
| Molecular Formula | C32H34Cl2N2O2Zr |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) |
| SMILES | C/N=C(/CC(O)c1ccccc1)c1ccccc1.C/N=C(/CC(O)c1ccccc1)c1ccccc1.Cl[Zr]Cl |
| InChI | InChI=1S/2C16H17NO.2ClH.Zr/c2*1-17-15(13-8-4-2-5-9-13)12-16(18)14-10-6-3-7-11-14;;;/h2*2-11,16,18H,12H2,1H3;2*1H;/q;;;;+2/p-2/b2*17-15-;;; |
| InChIKey | VJAWZIVDXWPGMA-BIHRYHCKSA-L |
| XLogP | 7.83 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol)?
The IUPAC name of dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) (CID 20870809) is dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol).
What is the SMILES notation for dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol)?
The canonical SMILES for dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) is C/N=C(/CC(O)c1ccccc1)c1ccccc1.C/N=C(/CC(O)c1ccccc1)c1ccccc1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol)?
The InChIKey is VJAWZIVDXWPGMA-BIHRYHCKSA-L. The full InChI is InChI=1S/2C16H17NO.2ClH.Zr/c2*1-17-15(13-8-4-2-5-9-13)12-16(18)14-10-6-3-7-11-14;;;/h2*2-11,16,18H,12H2,1H3;2*1H;/q;;;;+2/p-2/b2*17-15-;;;.
What are the key properties of dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol)?
dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) has a molecular weight of 640.77 g/mol, XLogP of 7.83, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;bis(3-methylimino-1,3-diphenylpropan-1-ol) is sourced from PubChem (CID 20870809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).