About N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine
N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine (PubChem CID 20870817) has the molecular formula C26H29N
and a molecular weight of 355.52 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine.
Molecular Properties
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine |
| PubChem CID | 20870817 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N/c1-19(2)23-16-11-17-24(20(3)4)26(23)27-25(22-14-9-6-10-15-22)18-21-12-7-5-8-13-21/h5-17,19-20H,18H2,1-4H3/b27-25+ |
| InChIKey | GCZKBQHADRCYPH-IMVLJIQESA-N |
| XLogP | 7.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine?
The IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine (CID 20870817) is N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine.
What is the SMILES notation for N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine?
The canonical SMILES for N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine is CC(C)c1cccc(C(C)C)c1/N=C(\Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine?
The InChIKey is GCZKBQHADRCYPH-IMVLJIQESA-N. The full InChI is InChI=1S/C26H29N/c1-19(2)23-16-11-17-24(20(3)4)26(23)27-25(22-14-9-6-10-15-22)18-21-12-7-5-8-13-21/h5-17,19-20H,18H2,1-4H3/b27-25+.
What are the key properties of N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine?
N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine has a molecular weight of 355.52 g/mol, XLogP of 7.30, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-di(propan-2-yl)phenyl]-1,2-diphenylethanimine is sourced from PubChem (CID 20870817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).