C51H60O3S3 — CID 20870940
4-[4-[4-[5-[5-(5-dec-1-ynylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihexoxyphenyl]cyclopenta-1,3-dien-1-yl]cyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 20870940) has the molecular formula C51H60O3S3 and a molecular weight of 817.24 g/mol. Its IUPAC name is 4-[4-[4-[5-[5-(5-dec-1-ynylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihexoxyphenyl]cyclopenta-1,3-dien-1-yl]cyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 4-[4-[4-[5-[5-(5-dec-1-ynylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihexoxyphenyl]cyclopenta-1,3-dien-1-yl]cyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 20870940 |
| Molecular Formula | C51H60O3S3 |
| Molecular Weight | 817.24 g/mol |
| Exact Mass | 816.37 |
| IUPAC Name | 4-[4-[4-[5-[5-(5-dec-1-ynylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihexoxyphenyl]cyclopenta-1,3-dien-1-yl]cyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CCCCCCCCC#Cc1ccc(-c2ccc(-c3ccc(-c4cc(OCCCCCC)c(C5=CC=C(C6=CC=C(C=O)C6)C5)cc4OCCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C51H60O3S3/c1-4-7-10-13-14-15-16-17-20-42-25-26-48(55-42)49-29-30-51(57-49)50-28-27-47(56-50)44-36-45(53-31-18-11-8-5-2)43(35-46(44)54-32-19-12-9-6-3)41-24-23-40(34-41)39-22-21-38(33-39)37-52/h21-30,35-37H,4-16,18-19,31-34H2,1-3H3 |
| InChIKey | WGAIVZYMXSRLCI-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.24 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|