About (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal
(2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal (PubChem CID 20871288) has the molecular formula C11H14O3Se
and a molecular weight of 273.19 g/mol. Its IUPAC name is (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal.
Molecular Properties
| Compound Name | (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal |
| PubChem CID | 20871288 |
| Molecular Formula | C11H14O3Se |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal |
| SMILES | O=C[C@@H](C[C@H](O)CO)[Se]c1ccccc1 |
| InChI | InChI=1S/C11H14O3Se/c12-7-9(14)6-11(8-13)15-10-4-2-1-3-5-10/h1-5,8-9,11-12,14H,6-7H2/t9-,11+/m0/s1 |
| InChIKey | UPTBPXZUUKGUBN-GXSJLCMTSA-N |
| XLogP | -0.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal?
The IUPAC name of (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal (CID 20871288) is (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal.
What is the SMILES notation for (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal?
The canonical SMILES for (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal is O=C[C@@H](C[C@H](O)CO)[Se]c1ccccc1.
What is the InChIKey of (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal?
The InChIKey is UPTBPXZUUKGUBN-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H14O3Se/c12-7-9(14)6-11(8-13)15-10-4-2-1-3-5-10/h1-5,8-9,11-12,14H,6-7H2/t9-,11+/m0/s1.
What are the key properties of (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal?
(2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal has a molecular weight of 273.19 g/mol, XLogP of -0.25, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4,5-dihydroxy-2-phenylselanylpentanal is sourced from PubChem (CID 20871288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).