C12H18F3NO3 — CID 20871711
N-(2,7-dimethyl-3,6-dioxooctan-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 20871711) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is N-(2,7-dimethyl-3,6-dioxooctan-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,7-dimethyl-3,6-dioxooctan-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 20871711 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2,7-dimethyl-3,6-dioxooctan-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC(C)C(=O)CC(NC(=O)C(F)(F)F)C(=O)C(C)C |
| InChI | InChI=1S/C12H18F3NO3/c1-6(2)9(17)5-8(10(18)7(3)4)16-11(19)12(13,14)15/h6-8H,5H2,1-4H3,(H,16,19) |
| InChIKey | MPUJASBTAGHBCT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |