About 2,7-dimethyl-4-(methylamino)octane-3,6-dione
2,7-dimethyl-4-(methylamino)octane-3,6-dione (PubChem CID 20871724) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2,7-dimethyl-4-(methylamino)octane-3,6-dione.
Molecular Properties
| Compound Name | 2,7-dimethyl-4-(methylamino)octane-3,6-dione |
| PubChem CID | 20871724 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2,7-dimethyl-4-(methylamino)octane-3,6-dione |
| SMILES | CNC(CC(=O)C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C11H21NO2/c1-7(2)10(13)6-9(12-5)11(14)8(3)4/h7-9,12H,6H2,1-5H3 |
| InChIKey | HUJGYGKHKPSXSN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethyl-4-(methylamino)octane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-4-(methylamino)octane-3,6-dione?
The IUPAC name of 2,7-dimethyl-4-(methylamino)octane-3,6-dione (CID 20871724) is 2,7-dimethyl-4-(methylamino)octane-3,6-dione.
What is the SMILES notation for 2,7-dimethyl-4-(methylamino)octane-3,6-dione?
The canonical SMILES for 2,7-dimethyl-4-(methylamino)octane-3,6-dione is CNC(CC(=O)C(C)C)C(=O)C(C)C.
What is the InChIKey of 2,7-dimethyl-4-(methylamino)octane-3,6-dione?
The InChIKey is HUJGYGKHKPSXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-7(2)10(13)6-9(12-5)11(14)8(3)4/h7-9,12H,6H2,1-5H3.
What are the key properties of 2,7-dimethyl-4-(methylamino)octane-3,6-dione?
2,7-dimethyl-4-(methylamino)octane-3,6-dione has a molecular weight of 199.29 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-4-(methylamino)octane-3,6-dione is sourced from PubChem (CID 20871724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).