About 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine
2,3-ditert-butyl-1,6-dimethyl-4H-pyridine (PubChem CID 20871967) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine |
| PubChem CID | 20871967 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine |
| SMILES | CC1=CCC(C(C)(C)C)=C(C(C)(C)C)N1C |
| InChI | InChI=1S/C15H27N/c1-11-9-10-12(14(2,3)4)13(16(11)8)15(5,6)7/h9H,10H2,1-8H3 |
| InChIKey | VYKMAQARHWQZLH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine?
The IUPAC name of 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine (CID 20871967) is 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine.
What is the SMILES notation for 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine?
The canonical SMILES for 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine is CC1=CCC(C(C)(C)C)=C(C(C)(C)C)N1C.
What is the InChIKey of 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine?
The InChIKey is VYKMAQARHWQZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-11-9-10-12(14(2,3)4)13(16(11)8)15(5,6)7/h9H,10H2,1-8H3.
What are the key properties of 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine?
2,3-ditert-butyl-1,6-dimethyl-4H-pyridine has a molecular weight of 221.39 g/mol, XLogP of 4.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-1,6-dimethyl-4H-pyridine is sourced from PubChem (CID 20871967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).