C18H35N — CID 20871970
1-butyl-5,6-ditert-butyl-2,3,4,7-tetrahydroazepine (PubChem CID 20871970) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 1-butyl-5,6-ditert-butyl-2,3,4,7-tetrahydroazepine.
| Compound Name | 1-butyl-5,6-ditert-butyl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 20871970 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 1-butyl-5,6-ditert-butyl-2,3,4,7-tetrahydroazepine |
| SMILES | CCCCN1CCCC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C18H35N/c1-8-9-12-19-13-10-11-15(17(2,3)4)16(14-19)18(5,6)7/h8-14H2,1-7H3 |
| InChIKey | AOJJQRKOZKUIGU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|