About 1-butyl-3,4-ditert-butyl-2H-pyridine
1-butyl-3,4-ditert-butyl-2H-pyridine (PubChem CID 20871974) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is 1-butyl-3,4-ditert-butyl-2H-pyridine.
Molecular Properties
| Compound Name | 1-butyl-3,4-ditert-butyl-2H-pyridine |
| PubChem CID | 20871974 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 1-butyl-3,4-ditert-butyl-2H-pyridine |
| SMILES | CCCCN1C=CC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H31N/c1-8-9-11-18-12-10-14(16(2,3)4)15(13-18)17(5,6)7/h10,12H,8-9,11,13H2,1-7H3 |
| InChIKey | PKTZPPPUFFSRFF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-3,4-ditert-butyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,4-ditert-butyl-2H-pyridine?
The IUPAC name of 1-butyl-3,4-ditert-butyl-2H-pyridine (CID 20871974) is 1-butyl-3,4-ditert-butyl-2H-pyridine.
What is the SMILES notation for 1-butyl-3,4-ditert-butyl-2H-pyridine?
The canonical SMILES for 1-butyl-3,4-ditert-butyl-2H-pyridine is CCCCN1C=CC(C(C)(C)C)=C(C(C)(C)C)C1.
What is the InChIKey of 1-butyl-3,4-ditert-butyl-2H-pyridine?
The InChIKey is PKTZPPPUFFSRFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N/c1-8-9-11-18-12-10-14(16(2,3)4)15(13-18)17(5,6)7/h10,12H,8-9,11,13H2,1-7H3.
What are the key properties of 1-butyl-3,4-ditert-butyl-2H-pyridine?
1-butyl-3,4-ditert-butyl-2H-pyridine has a molecular weight of 249.44 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,4-ditert-butyl-2H-pyridine is sourced from PubChem (CID 20871974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).