About 1-butyl-5,6-ditert-butyl-2H-azepin-7-one
1-butyl-5,6-ditert-butyl-2H-azepin-7-one (PubChem CID 20871980) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-butyl-5,6-ditert-butyl-2H-azepin-7-one.
Molecular Properties
| Compound Name | 1-butyl-5,6-ditert-butyl-2H-azepin-7-one |
| PubChem CID | 20871980 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-butyl-5,6-ditert-butyl-2H-azepin-7-one |
| SMILES | CCCCN1CC=CC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H31NO/c1-8-9-12-19-13-10-11-14(17(2,3)4)15(16(19)20)18(5,6)7/h10-11H,8-9,12-13H2,1-7H3 |
| InChIKey | YJQXBWNXBCQRAV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-5,6-ditert-butyl-2H-azepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5,6-ditert-butyl-2H-azepin-7-one?
The IUPAC name of 1-butyl-5,6-ditert-butyl-2H-azepin-7-one (CID 20871980) is 1-butyl-5,6-ditert-butyl-2H-azepin-7-one.
What is the SMILES notation for 1-butyl-5,6-ditert-butyl-2H-azepin-7-one?
The canonical SMILES for 1-butyl-5,6-ditert-butyl-2H-azepin-7-one is CCCCN1CC=CC(C(C)(C)C)=C(C(C)(C)C)C1=O.
What is the InChIKey of 1-butyl-5,6-ditert-butyl-2H-azepin-7-one?
The InChIKey is YJQXBWNXBCQRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-8-9-12-19-13-10-11-14(17(2,3)4)15(16(19)20)18(5,6)7/h10-11H,8-9,12-13H2,1-7H3.
What are the key properties of 1-butyl-5,6-ditert-butyl-2H-azepin-7-one?
1-butyl-5,6-ditert-butyl-2H-azepin-7-one has a molecular weight of 277.45 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5,6-ditert-butyl-2H-azepin-7-one is sourced from PubChem (CID 20871980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).