About 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione
2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione (PubChem CID 20871986) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione |
| PubChem CID | 20871986 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione |
| SMILES | CCCCn1[nH]c(=O)c(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C16H28N2O2/c1-8-9-10-18-14(20)12(16(5,6)7)11(13(19)17-18)15(2,3)4/h8-10H2,1-7H3,(H,17,19) |
| InChIKey | DEEMIMNKQLFHOU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione?
The IUPAC name of 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione (CID 20871986) is 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione is CCCCn1[nH]c(=O)c(C(C)(C)C)c(C(C)(C)C)c1=O.
What is the InChIKey of 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione?
The InChIKey is DEEMIMNKQLFHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-8-9-10-18-14(20)12(16(5,6)7)11(13(19)17-18)15(2,3)4/h8-10H2,1-7H3,(H,17,19).
What are the key properties of 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione?
2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione has a molecular weight of 280.41 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,5-ditert-butyl-1H-pyridazine-3,6-dione is sourced from PubChem (CID 20871986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).