C16H27NO3 — CID 20872089
3-butyl-5,6-ditert-butyl-1,3-oxazine-2,4-dione (PubChem CID 20872089) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-1,3-oxazine-2,4-dione.
| Compound Name | 3-butyl-5,6-ditert-butyl-1,3-oxazine-2,4-dione |
|---|---|
| PubChem CID | 20872089 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-1,3-oxazine-2,4-dione |
| SMILES | CCCCn1c(=O)oc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C16H27NO3/c1-8-9-10-17-13(18)11(15(2,3)4)12(16(5,6)7)20-14(17)19/h8-10H2,1-7H3 |
| InChIKey | BDOWBPCDLGBOCI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |