About 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione
5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione (PubChem CID 20872117) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione |
| PubChem CID | 20872117 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione |
| SMILES | Cn1c(=O)oc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C13H21NO3/c1-12(2,3)8-9(13(4,5)6)17-11(16)14(7)10(8)15/h1-7H3 |
| InChIKey | RVHJTBOBDCAWOI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione?
The IUPAC name of 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione (CID 20872117) is 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione.
What is the SMILES notation for 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione?
The canonical SMILES for 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione is Cn1c(=O)oc(C(C)(C)C)c(C(C)(C)C)c1=O.
What is the InChIKey of 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione?
The InChIKey is RVHJTBOBDCAWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-12(2,3)8-9(13(4,5)6)17-11(16)14(7)10(8)15/h1-7H3.
What are the key properties of 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione?
5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione has a molecular weight of 239.31 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-3-methyl-1,3-oxazine-2,4-dione is sourced from PubChem (CID 20872117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).