About 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one
5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one (PubChem CID 20872118) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one |
| PubChem CID | 20872118 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one |
| SMILES | CN1COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H23NO2/c1-12(2,3)9-10(13(4,5)6)16-8-14(7)11(9)15/h8H2,1-7H3 |
| InChIKey | SWYWFQWYTVUMHU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one?
The IUPAC name of 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one (CID 20872118) is 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one is CN1COC(C(C)(C)C)=C(C(C)(C)C)C1=O.
What is the InChIKey of 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one?
The InChIKey is SWYWFQWYTVUMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-12(2,3)9-10(13(4,5)6)16-8-14(7)11(9)15/h8H2,1-7H3.
What are the key properties of 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one?
5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one has a molecular weight of 225.33 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-3-methyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 20872118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).