C17H29NO3 — CID 20872146
4-butyl-6,7-ditert-butyl-1,4-oxazepine-3,5-dione (PubChem CID 20872146) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 4-butyl-6,7-ditert-butyl-1,4-oxazepine-3,5-dione.
| Compound Name | 4-butyl-6,7-ditert-butyl-1,4-oxazepine-3,5-dione |
|---|---|
| PubChem CID | 20872146 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-butyl-6,7-ditert-butyl-1,4-oxazepine-3,5-dione |
| SMILES | CCCCN1C(=O)COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H29NO3/c1-8-9-10-18-12(19)11-21-14(17(5,6)7)13(15(18)20)16(2,3)4/h8-11H2,1-7H3 |
| InChIKey | QCTVTUVWUNLHIL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|