C17H31NO2 — CID 20872147
4-butyl-6,7-ditert-butyl-2,3-dihydro-1,4-oxazepin-5-one (PubChem CID 20872147) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-butyl-6,7-ditert-butyl-2,3-dihydro-1,4-oxazepin-5-one.
| Compound Name | 4-butyl-6,7-ditert-butyl-2,3-dihydro-1,4-oxazepin-5-one |
|---|---|
| PubChem CID | 20872147 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 4-butyl-6,7-ditert-butyl-2,3-dihydro-1,4-oxazepin-5-one |
| SMILES | CCCCN1CCOC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H31NO2/c1-8-9-10-18-11-12-20-14(17(5,6)7)13(15(18)19)16(2,3)4/h8-12H2,1-7H3 |
| InChIKey | UXIOZXOIUJNDCP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |