C17H32N2O — CID 20872149
4-butyl-6,7-ditert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one (PubChem CID 20872149) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 4-butyl-6,7-ditert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one.
| Compound Name | 4-butyl-6,7-ditert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one |
|---|---|
| PubChem CID | 20872149 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 4-butyl-6,7-ditert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one |
| SMILES | CCCCN1CC(=O)NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32N2O/c1-8-9-10-19-11-13(16(2,3)4)15(17(5,6)7)18-14(20)12-19/h8-12H2,1-7H3,(H,18,20) |
| InChIKey | LPFVPJJNRQGFHD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |