About 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one
1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one (PubChem CID 20872151) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one.
Molecular Properties
| Compound Name | 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one |
| PubChem CID | 20872151 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one |
| SMILES | CCCCN1CC=NC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H30N2O/c1-8-9-11-19-12-10-18-14(17(5,6)7)13(15(19)20)16(2,3)4/h10H,8-9,11-12H2,1-7H3 |
| InChIKey | KATMJMJPIXWDTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one?
The IUPAC name of 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one (CID 20872151) is 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one.
What is the SMILES notation for 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one?
The canonical SMILES for 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one is CCCCN1CC=NC(C(C)(C)C)=C(C(C)(C)C)C1=O.
What is the InChIKey of 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one?
The InChIKey is KATMJMJPIXWDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O/c1-8-9-11-19-12-10-18-14(17(5,6)7)13(15(19)20)16(2,3)4/h10H,8-9,11-12H2,1-7H3.
What are the key properties of 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one?
1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one has a molecular weight of 278.44 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5,6-ditert-butyl-2H-1,4-diazepin-7-one is sourced from PubChem (CID 20872151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).