About 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine
2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine (PubChem CID 20872190) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 20872190 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine |
| SMILES | CCCCC1CCC(C(C)(C)C)=C(C(C)(C)C)N1C |
| InChI | InChI=1S/C18H35N/c1-9-10-11-14-12-13-15(17(2,3)4)16(19(14)8)18(5,6)7/h14H,9-13H2,1-8H3 |
| InChIKey | OSYPSPCAGXRUBW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine (CID 20872190) is 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine is CCCCC1CCC(C(C)(C)C)=C(C(C)(C)C)N1C.
What is the InChIKey of 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine?
The InChIKey is OSYPSPCAGXRUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N/c1-9-10-11-14-12-13-15(17(2,3)4)16(19(14)8)18(5,6)7/h14H,9-13H2,1-8H3.
What are the key properties of 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine?
2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine has a molecular weight of 265.48 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5,6-ditert-butyl-1-methyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 20872190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).