About 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one
2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one (PubChem CID 20872191) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one.
Molecular Properties
| Compound Name | 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one |
| PubChem CID | 20872191 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one |
| SMILES | CCCCC1CC(=O)C(C(C)(C)C)=C(C(C)(C)C)N1C |
| InChI | InChI=1S/C18H33NO/c1-9-10-11-13-12-14(20)15(17(2,3)4)16(19(13)8)18(5,6)7/h13H,9-12H2,1-8H3 |
| InChIKey | TVCUNSZQJRLUBA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one?
The IUPAC name of 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one (CID 20872191) is 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one.
What is the SMILES notation for 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one?
The canonical SMILES for 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one is CCCCC1CC(=O)C(C(C)(C)C)=C(C(C)(C)C)N1C.
What is the InChIKey of 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one?
The InChIKey is TVCUNSZQJRLUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO/c1-9-10-11-13-12-14(20)15(17(2,3)4)16(19(13)8)18(5,6)7/h13H,9-12H2,1-8H3.
What are the key properties of 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one?
2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one has a molecular weight of 279.47 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5,6-ditert-butyl-1-methyl-2,3-dihydropyridin-4-one is sourced from PubChem (CID 20872191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).