C9H13NO — CID 20872596
3,5-diethyl-1H-pyridin-2-one (PubChem CID 20872596) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3,5-diethyl-1H-pyridin-2-one.
| Compound Name | 3,5-diethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 20872596 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3,5-diethyl-1H-pyridin-2-one |
| SMILES | CCc1c[nH]c(=O)c(CC)c1 |
| InChI | InChI=1S/C9H13NO/c1-3-7-5-8(4-2)9(11)10-6-7/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | ZZXHZQSHSABVFU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |