About [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate
[(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate (PubChem CID 20872793) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate.
Molecular Properties
| Compound Name | [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate |
| PubChem CID | 20872793 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)O/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-2-3-4-5-6-7-8-12-19-28-23-17-15-22(16-18-23)26-24(27)29-25-20-21-13-10-9-11-14-21/h9-11,13-18,20H,2-8,12,19H2,1H3,(H,26,27)/b25-20+ |
| InChIKey | LFWYEOAFEYYRNZ-LKUDQCMESA-N |
| XLogP | 6.79 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate?
The IUPAC name of [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate (CID 20872793) is [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate.
What is the SMILES notation for [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate?
The canonical SMILES for [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate is CCCCCCCCCCOc1ccc(NC(=O)O/N=C/c2ccccc2)cc1.
What is the InChIKey of [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate?
The InChIKey is LFWYEOAFEYYRNZ-LKUDQCMESA-N. The full InChI is InChI=1S/C24H32N2O3/c1-2-3-4-5-6-7-8-12-19-28-23-17-15-22(16-18-23)26-24(27)29-25-20-21-13-10-9-11-14-21/h9-11,13-18,20H,2-8,12,19H2,1H3,(H,26,27)/b25-20+.
What are the key properties of [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate?
[(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate has a molecular weight of 396.53 g/mol, XLogP of 6.79, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-benzylideneamino] N-(4-decoxyphenyl)carbamate is sourced from PubChem (CID 20872793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).