About 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate
2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate (PubChem CID 20872981) has the molecular formula C28H46O9
and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate |
| PubChem CID | 20872981 |
| Molecular Formula | C28H46O9 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)OCCC(CC)(COC(C)COC(=O)C(=C)C)COC(C)COC(=O)C(=C)C |
| InChI | InChI=1S/C28H46O9/c1-11-28(17-36-23(9)15-34-26(30)20(4)5,18-37-24(10)16-35-27(31)21(6)7)12-13-32-22(8)14-33-25(29)19(2)3/h22-24H,2,4,6,11-18H2,1,3,5,7-10H3 |
| InChIKey | GUWHTJYFIJXYAD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate?
The IUPAC name of 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate (CID 20872981) is 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate?
The canonical SMILES for 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC(C)OCCC(CC)(COC(C)COC(=O)C(=C)C)COC(C)COC(=O)C(=C)C.
What is the InChIKey of 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate?
The InChIKey is GUWHTJYFIJXYAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46O9/c1-11-28(17-36-23(9)15-34-26(30)20(4)5,18-37-24(10)16-35-27(31)21(6)7)12-13-32-22(8)14-33-25(29)19(2)3/h22-24H,2,4,6,11-18H2,1,3,5,7-10H3.
What are the key properties of 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate?
2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate has a molecular weight of 526.67 g/mol, XLogP of 4.35, 20 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-bis[1-(2-methylprop-2-enoyloxy)propan-2-yloxymethyl]pentoxy]propyl 2-methylprop-2-enoate is sourced from PubChem (CID 20872981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).