C21H32N4O6 — CID 20872991
4-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butyl N-isocyanatocarbamate (PubChem CID 20872991) has the molecular formula C21H32N4O6 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butyl N-isocyanatocarbamate.
| Compound Name | 4-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butyl N-isocyanatocarbamate |
|---|---|
| PubChem CID | 20872991 |
| Molecular Formula | C21H32N4O6 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butyl N-isocyanatocarbamate |
| SMILES | O=C=NNC(=O)OCCCCOC(=O)NC1CCC(CC2CCC(N=C=O)CC2)CC1 |
| InChI | InChI=1S/C21H32N4O6/c26-14-22-18-7-3-16(4-8-18)13-17-5-9-19(10-6-17)24-20(28)30-11-1-2-12-31-21(29)25-23-15-27/h16-19H,1-13H2,(H,24,28)(H,25,29) |
| InChIKey | FUUCUIQGDNJFMW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|