C22H24FN3O4S2 — CID 2087304
N,N-diethyl-3-[5-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 2087304) has the molecular formula C22H24FN3O4S2 and a molecular weight of 477.58 g/mol. Its IUPAC name is N,N-diethyl-3-[5-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2087304 |
| Molecular Formula | C22H24FN3O4S2 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N,N-diethyl-3-[5-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCCC(=O)c3ccc(F)cc3)o2)c1 |
| InChI | InChI=1S/C22H24FN3O4S2/c1-3-26(4-2)32(28,29)19-8-5-7-17(15-19)21-24-25-22(30-21)31-14-6-9-20(27)16-10-12-18(23)13-11-16/h5,7-8,10-13,15H,3-4,6,9,14H2,1-2H3 |
| InChIKey | RKTZBNNCCQDEIU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|