C27H25N5O6 — CID 20873286
3-(3,4-dimethoxyphenyl)-N-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 20873286) has the molecular formula C27H25N5O6 and a molecular weight of 515.53 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 20873286 |
| Molecular Formula | C27H25N5O6 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COc1ccc(-c2noc(N(c3nc(-c4ccc(OC)c(OC)c4)no3)c3ccccc3C)n2)cc1OC |
| InChI | InChI=1S/C27H25N5O6/c1-16-8-6-7-9-19(16)32(26-28-24(30-37-26)17-10-12-20(33-2)22(14-17)35-4)27-29-25(31-38-27)18-11-13-21(34-3)23(15-18)36-5/h6-15H,1-5H3 |
| InChIKey | DFFSUTGIGXCKRO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 118.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |