About methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate
methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate (PubChem CID 20873542) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate |
| PubChem CID | 20873542 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate |
| SMILES | COC(=O)C1Cc2nccn2C(=O)N1 |
| InChI | InChI=1S/C8H9N3O3/c1-14-7(12)5-4-6-9-2-3-11(6)8(13)10-5/h2-3,5H,4H2,1H3,(H,10,13) |
| InChIKey | FAKFXGPALYHSKE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate?
The IUPAC name of methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate (CID 20873542) is methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate.
What is the SMILES notation for methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate?
The canonical SMILES for methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate is COC(=O)C1Cc2nccn2C(=O)N1.
What is the InChIKey of methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate?
The InChIKey is FAKFXGPALYHSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-14-7(12)5-4-6-9-2-3-11(6)8(13)10-5/h2-3,5H,4H2,1H3,(H,10,13).
What are the key properties of methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate?
methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate has a molecular weight of 195.18 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-7,8-dihydro-6H-imidazo[1,2-c]pyrimidine-7-carboxylate is sourced from PubChem (CID 20873542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).