C22H16ClN5 — CID 20874438
N-benzyl-3-(4-chlorophenyl)triazolo[1,5-a]quinazolin-5-amine (PubChem CID 20874438) has the molecular formula C22H16ClN5 and a molecular weight of 385.86 g/mol. Its IUPAC name is N-benzyl-3-(4-chlorophenyl)triazolo[1,5-a]quinazolin-5-amine.
| Compound Name | N-benzyl-3-(4-chlorophenyl)triazolo[1,5-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 20874438 |
| Molecular Formula | C22H16ClN5 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-benzyl-3-(4-chlorophenyl)triazolo[1,5-a]quinazolin-5-amine |
| SMILES | Clc1ccc(-c2nnn3c2nc(NCc2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C22H16ClN5/c23-17-12-10-16(11-13-17)20-22-25-21(24-14-15-6-2-1-3-7-15)18-8-4-5-9-19(18)28(22)27-26-20/h1-13H,14H2,(H,24,25) |
| InChIKey | OQGCSBRAFXJECN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |