C26H27N7O — CID 20874875
N-cyclohexyl-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butanamide (PubChem CID 20874875) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is N-cyclohexyl-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butanamide.
| Compound Name | N-cyclohexyl-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butanamide |
|---|---|
| PubChem CID | 20874875 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-cyclohexyl-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butanamide |
| SMILES | O=C(CCCc1nnc2n3nc(-c4ccccc4)nc3c3ccccc3n12)NC1CCCCC1 |
| InChI | InChI=1S/C26H27N7O/c34-23(27-19-12-5-2-6-13-19)17-9-16-22-29-30-26-32(22)21-15-8-7-14-20(21)25-28-24(31-33(25)26)18-10-3-1-4-11-18/h1,3-4,7-8,10-11,14-15,19H,2,5-6,9,12-13,16-17H2,(H,27,34) |
| InChIKey | XMDXQCYFTWZOCM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |