About 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide
2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 20875456) has the molecular formula C15H15N3O4S
and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide |
| PubChem CID | 20875456 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | COCCn1c(=O)c2sc3ccccc3c2n(CC(N)=O)c1=O |
| InChI | InChI=1S/C15H15N3O4S/c1-22-7-6-17-14(20)13-12(18(15(17)21)8-11(16)19)9-4-2-3-5-10(9)23-13/h2-5H,6-8H2,1H3,(H2,16,19) |
| InChIKey | MJUYIIPJFABFGS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide?
The IUPAC name of 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide (CID 20875456) is 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide.
What is the SMILES notation for 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide?
The canonical SMILES for 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide is COCCn1c(=O)c2sc3ccccc3c2n(CC(N)=O)c1=O.
What is the InChIKey of 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide?
The InChIKey is MJUYIIPJFABFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4S/c1-22-7-6-17-14(20)13-12(18(15(17)21)8-11(16)19)9-4-2-3-5-10(9)23-13/h2-5H,6-8H2,1H3,(H2,16,19).
What are the key properties of 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide?
2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide has a molecular weight of 333.37 g/mol, XLogP of 0.51, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]acetamide is sourced from PubChem (CID 20875456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).