C16H16N4O3S — CID 2087569
N-(furan-2-ylmethylcarbamoyl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 2087569) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2087569 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc2nc(SCC(=O)NC(=O)NCc3ccco3)[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O3S/c1-10-4-5-12-13(7-10)19-16(18-12)24-9-14(21)20-15(22)17-8-11-3-2-6-23-11/h2-7H,8-9H2,1H3,(H,18,19)(H2,17,20,21,22) |
| InChIKey | YJUPYQLEKSNQFO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |