C21H24N4O3 — CID 20875840
N-(3-ethoxypropyl)-2-[1-oxo-4-(pyridin-4-ylmethyl)phthalazin-2-yl]acetamide (PubChem CID 20875840) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[1-oxo-4-(pyridin-4-ylmethyl)phthalazin-2-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[1-oxo-4-(pyridin-4-ylmethyl)phthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 20875840 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[1-oxo-4-(pyridin-4-ylmethyl)phthalazin-2-yl]acetamide |
| SMILES | CCOCCCNC(=O)Cn1nc(Cc2ccncc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H24N4O3/c1-2-28-13-5-10-23-20(26)15-25-21(27)18-7-4-3-6-17(18)19(24-25)14-16-8-11-22-12-9-16/h3-4,6-9,11-12H,2,5,10,13-15H2,1H3,(H,23,26) |
| InChIKey | YUPAVASRWZQSAX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|