C16H12F3N3O4S — CID 20876167
2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 20876167) has the molecular formula C16H12F3N3O4S and a molecular weight of 399.35 g/mol. Its IUPAC name is 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 20876167 |
| Molecular Formula | C16H12F3N3O4S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | O=C1CC(=O)Nc2cc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)ccc2N1 |
| InChI | InChI=1S/C16H12F3N3O4S/c17-16(18,19)9-2-1-3-10(6-9)22-27(25,26)11-4-5-12-13(7-11)21-15(24)8-14(23)20-12/h1-7,22H,8H2,(H,20,23)(H,21,24) |
| InChIKey | WACFFXGCPMDUGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|