About ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate
ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate (PubChem CID 20876843) has the molecular formula C15H16N2O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate |
| PubChem CID | 20876843 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1oc2cc3sc(N(C)C)nc3cc2c1C |
| InChI | InChI=1S/C15H16N2O3S/c1-5-19-14(18)13-8(2)9-6-10-12(7-11(9)20-13)21-15(16-10)17(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | FCIFLZRPTSYEON-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate?
The IUPAC name of ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate (CID 20876843) is ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate.
What is the SMILES notation for ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate?
The canonical SMILES for ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate is CCOC(=O)c1oc2cc3sc(N(C)C)nc3cc2c1C.
What is the InChIKey of ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate?
The InChIKey is FCIFLZRPTSYEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3S/c1-5-19-14(18)13-8(2)9-6-10-12(7-11(9)20-13)21-15(16-10)17(3)4/h6-7H,5H2,1-4H3.
What are the key properties of ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate?
ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate has a molecular weight of 304.37 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(dimethylamino)-7-methylfuro[3,2-f][1,3]benzothiazole-6-carboxylate is sourced from PubChem (CID 20876843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).