About N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide
N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 20877826) has the molecular formula C20H16FNO2S
and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide |
| PubChem CID | 20877826 |
| Molecular Formula | C20H16FNO2S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cccc2c1-c1sc(C(=O)N(C)c3ccc(F)cc3)cc1CO2 |
| InChI | InChI=1S/C20H16FNO2S/c1-12-4-3-5-16-18(12)19-13(11-24-16)10-17(25-19)20(23)22(2)15-8-6-14(21)7-9-15/h3-10H,11H2,1-2H3 |
| InChIKey | NXGRYGXDLNQGHB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide?
The IUPAC name of N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide (CID 20877826) is N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide.
What is the SMILES notation for N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide?
The canonical SMILES for N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide is Cc1cccc2c1-c1sc(C(=O)N(C)c3ccc(F)cc3)cc1CO2.
What is the InChIKey of N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide?
The InChIKey is NXGRYGXDLNQGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNO2S/c1-12-4-3-5-16-18(12)19-13(11-24-16)10-17(25-19)20(23)22(2)15-8-6-14(21)7-9-15/h3-10H,11H2,1-2H3.
What are the key properties of N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide?
N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide has a molecular weight of 353.42 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N,9-dimethyl-4H-thieno[3,2-c]chromene-2-carboxamide is sourced from PubChem (CID 20877826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).