About ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate
ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate (PubChem CID 20877853) has the molecular formula C20H21NO4S
and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 20877853 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc3c(s2)-c2ccccc2OC3)CC1 |
| InChI | InChI=1S/C20H21NO4S/c1-2-24-20(23)13-7-9-21(10-8-13)19(22)17-11-14-12-25-16-6-4-3-5-15(16)18(14)26-17/h3-6,11,13H,2,7-10,12H2,1H3 |
| InChIKey | AHAXTSJEUDPYDC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate (CID 20877853) is ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2cc3c(s2)-c2ccccc2OC3)CC1.
What is the InChIKey of ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate?
The InChIKey is AHAXTSJEUDPYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4S/c1-2-24-20(23)13-7-9-21(10-8-13)19(22)17-11-14-12-25-16-6-4-3-5-15(16)18(14)26-17/h3-6,11,13H,2,7-10,12H2,1H3.
What are the key properties of ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate?
ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate has a molecular weight of 371.46 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4H-thieno[3,2-c]chromene-2-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 20877853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).