C17H22N2O2S — CID 20878066
N-cyclohexyl-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide (PubChem CID 20878066) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 20878066 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-cyclohexyl-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
| SMILES | O=C(CN1C(=O)CCSc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C17H22N2O2S/c20-16(18-13-6-2-1-3-7-13)12-19-14-8-4-5-9-15(14)22-11-10-17(19)21/h4-5,8-9,13H,1-3,6-7,10-12H2,(H,18,20) |
| InChIKey | QWYZBZPWWMNNMS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |