C15H16N6O3S2 — CID 2087821
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2087821) has the molecular formula C15H16N6O3S2 and a molecular weight of 392.47 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2087821 |
| Molecular Formula | C15H16N6O3S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)NCCN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C15H16N6O3S2/c1-10-3-2-4-11(7-10)21-14(17-18-19-21)25-8-12(22)16-5-6-20-13(23)9-26-15(20)24/h2-4,7H,5-6,8-9H2,1H3,(H,16,22) |
| InChIKey | SFVBGKDUDRANCJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|