C25H23N5O2S — CID 20878535
N-benzyl-3-(2,4,6-trimethylphenyl)sulfonyltriazolo[1,5-a]quinazolin-5-amine (PubChem CID 20878535) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-benzyl-3-(2,4,6-trimethylphenyl)sulfonyltriazolo[1,5-a]quinazolin-5-amine.
| Compound Name | N-benzyl-3-(2,4,6-trimethylphenyl)sulfonyltriazolo[1,5-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 20878535 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-benzyl-3-(2,4,6-trimethylphenyl)sulfonyltriazolo[1,5-a]quinazolin-5-amine |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2nnn3c2nc(NCc2ccccc2)c2ccccc23)c(C)c1 |
| InChI | InChI=1S/C25H23N5O2S/c1-16-13-17(2)22(18(3)14-16)33(31,32)25-24-27-23(26-15-19-9-5-4-6-10-19)20-11-7-8-12-21(20)30(24)29-28-25/h4-14H,15H2,1-3H3,(H,26,27) |
| InChIKey | COCAKXIZJVWWBQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |