C12H13N5O — CID 20880195
N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 20880195) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 20880195 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | COCCNc1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C12H13N5O/c1-18-7-6-13-11-12-16-14-8-17(12)10-5-3-2-4-9(10)15-11/h2-5,8H,6-7H2,1H3,(H,13,15) |
| InChIKey | UGBYIKRXCNEIRB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|