C16H13N5 — CID 20880203
8-methyl-N-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 20880203) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 8-methyl-N-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | 8-methyl-N-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 20880203 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 8-methyl-N-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | Cc1ccc2nc(Nc3ccccc3)c3nncn3c2c1 |
| InChI | InChI=1S/C16H13N5/c1-11-7-8-13-14(9-11)21-10-17-20-16(21)15(19-13)18-12-5-3-2-4-6-12/h2-10H,1H3,(H,18,19) |
| InChIKey | UJPYYAFGDXWGBM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |