C23H20FN3O3S2 — CID 20881331
2-[3-(4-fluorophenyl)-5-oxo-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-4-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 20881331) has the molecular formula C23H20FN3O3S2 and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-5-oxo-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-4-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-5-oxo-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-4-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 20881331 |
| Molecular Formula | C23H20FN3O3S2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-5-oxo-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-4-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1c(=O)c2ccccc2n2c(=S)sc(-c3ccc(F)cc3)c12)NCC1CCCO1 |
| InChI | InChI=1S/C23H20FN3O3S2/c24-15-9-7-14(8-10-15)20-21-26(13-19(28)25-12-16-4-3-11-30-16)22(29)17-5-1-2-6-18(17)27(21)23(31)32-20/h1-2,5-10,16H,3-4,11-13H2,(H,25,28) |
| InChIKey | DMKQYLPPWZYDRE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|