C23H24N2O3S2 — CID 20881350
3-(3,4-diethoxyphenyl)-4-propan-2-yl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one (PubChem CID 20881350) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-4-propan-2-yl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one.
| Compound Name | 3-(3,4-diethoxyphenyl)-4-propan-2-yl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
|---|---|
| PubChem CID | 20881350 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-4-propan-2-yl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
| SMILES | CCOc1ccc(-c2sc(=S)n3c4ccccc4c(=O)n(C(C)C)c23)cc1OCC |
| InChI | InChI=1S/C23H24N2O3S2/c1-5-27-18-12-11-15(13-19(18)28-6-2)20-21-24(14(3)4)22(26)16-9-7-8-10-17(16)25(21)23(29)30-20/h7-14H,5-6H2,1-4H3 |
| InChIKey | ZCWHLVPZRARLKK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|