C24H17FN2OS2 — CID 20881392
4-[(2-fluorophenyl)methyl]-3-(2-methylphenyl)-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one (PubChem CID 20881392) has the molecular formula C24H17FN2OS2 and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methyl]-3-(2-methylphenyl)-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one.
| Compound Name | 4-[(2-fluorophenyl)methyl]-3-(2-methylphenyl)-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
|---|---|
| PubChem CID | 20881392 |
| Molecular Formula | C24H17FN2OS2 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[(2-fluorophenyl)methyl]-3-(2-methylphenyl)-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
| SMILES | Cc1ccccc1-c1sc(=S)n2c3ccccc3c(=O)n(Cc3ccccc3F)c12 |
| InChI | InChI=1S/C24H17FN2OS2/c1-15-8-2-4-10-17(15)21-22-26(14-16-9-3-6-12-19(16)25)23(28)18-11-5-7-13-20(18)27(22)24(29)30-21/h2-13H,14H2,1H3 |
| InChIKey | WGALRMMSHPIJFL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|