About ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate
ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate (PubChem CID 20881628) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate |
| PubChem CID | 20881628 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CC2Oc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-2-25-19(24)12-6-5-7-13(10-12)20-17(22)11-16-18(23)21-14-8-3-4-9-15(14)26-16/h3-10,16H,2,11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | JQIPTJVRSOKQHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate?
The IUPAC name of ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate (CID 20881628) is ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate.
What is the SMILES notation for ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate?
The canonical SMILES for ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate is CCOC(=O)c1cccc(NC(=O)CC2Oc3ccccc3NC2=O)c1.
What is the InChIKey of ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate?
The InChIKey is JQIPTJVRSOKQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-2-25-19(24)12-6-5-7-13(10-12)20-17(22)11-16-18(23)21-14-8-3-4-9-15(14)26-16/h3-10,16H,2,11H2,1H3,(H,20,22)(H,21,23).
What are the key properties of ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate?
ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate has a molecular weight of 354.36 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate is sourced from PubChem (CID 20881628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).