C20H20N2O5 — CID 20881689
ethyl 3-[[2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate (PubChem CID 20881689) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 3-[[2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 20881689 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 3-[[2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CC2Oc3ccc(C)cc3NC2=O)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-3-26-20(25)13-5-4-6-14(10-13)21-18(23)11-17-19(24)22-15-9-12(2)7-8-16(15)27-17/h4-10,17H,3,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | UGWPMAXCOOYJOX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |