C29H34N6OS — CID 20883689
N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide (PubChem CID 20883689) has the molecular formula C29H34N6OS and a molecular weight of 514.70 g/mol. Its IUPAC name is N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide.
| Compound Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 20883689 |
| Molecular Formula | C29H34N6OS |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide |
| SMILES | Cc1ccc(C)c(N2CCN(CCCNC(=O)c3ccc(CSc4nc5ccncc5[nH]4)cc3)CC2)c1 |
| InChI | InChI=1S/C29H34N6OS/c1-21-4-5-22(2)27(18-21)35-16-14-34(15-17-35)13-3-11-31-28(36)24-8-6-23(7-9-24)20-37-29-32-25-10-12-30-19-26(25)33-29/h4-10,12,18-19H,3,11,13-17,20H2,1-2H3,(H,31,36)(H,32,33) |
| InChIKey | WZUQDPRRGAUULG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|