C18H13Cl2N3O2S — CID 2088382
(3R)-3-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]oxolan-2-one (PubChem CID 2088382) has the molecular formula C18H13Cl2N3O2S and a molecular weight of 406.29 g/mol. Its IUPAC name is (3R)-3-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]oxolan-2-one.
| Compound Name | (3R)-3-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 2088382 |
| Molecular Formula | C18H13Cl2N3O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (3R)-3-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O2S/c19-12-3-1-11(2-4-12)16-21-22-18(26-15-9-10-25-17(15)24)23(16)14-7-5-13(20)6-8-14/h1-8,15H,9-10H2/t15-/m1/s1 |
| InChIKey | QZAZQYASVLZKJQ-OAHLLOKOSA-N |
| XLogP | 4.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |