C17H18ClNO4 — CID 2088418
(2R)-2-(4-chlorophenoxy)-N-(3,4-dimethoxyphenyl)propanamide (PubChem CID 2088418) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2088418 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C17H18ClNO4/c1-11(23-14-7-4-12(18)5-8-14)17(20)19-13-6-9-15(21-2)16(10-13)22-3/h4-11H,1-3H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | FSIYSZOPOUOKOV-LLVKDONJSA-N |
| XLogP | 3.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |