C19H18N4O3 — CID 20885621
2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(1-phenylethyl)propanamide (PubChem CID 20885621) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(1-phenylethyl)propanamide.
| Compound Name | 2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 20885621 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(1-phenylethyl)propanamide |
| SMILES | CC(NC(=O)C(C)n1ncn2c(cc3occc32)c1=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O3/c1-12(14-6-4-3-5-7-14)21-18(24)13(2)23-19(25)16-10-17-15(8-9-26-17)22(16)11-20-23/h3-13H,1-2H3,(H,21,24) |
| InChIKey | QOEMFGVXQDOCQX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |